Browsing Serum Metabolites
Clicking on any metabolite link will take you to the Human Metabolome Database.
Displaying metabolites 31661 - 31680 of 37230 in total
| HMDB ID CAS Number | Name | Structure | Formula Average Mass Monoisotopic Mass | Biospecimen Location |
|---|---|---|---|---|
| HMDB0006809 4013-06-3 | Nicotinic acid ribonucleoside | C11H14NO6 256.232 256.082112185 |
| |
| HMDB0012235 | Hydroxybupropion | C13H18ClNO2 255.741 255.102606532 |
| |
| HMDB0014406 68475-42-3 | Anagrelide | C10H7Cl2N3O 256.088 254.996617275 |
| |
| HMDB0014695 84057-84-1 | Lamotrigine | C9H7Cl2N5 256.091 255.007850663 |
| |
| HMDB0060649 37627-95-5 | Ascorbic acid 2-sulfate | C6H8O9S 256.18 255.988903012 |
| |
| HMDB0061744 | Mono-benzyl phthalate | C15H12O4 256.2534 256.073558872 |
| |
| HMDB0240465 | 4-Methylumbelliferone sulfate | C10H8O6S 256.23 256.004159152 |
| |
| HMDB0240641 22430-27-9 | Ascorbic acid 3-sulfate | C6H8O9S 256.18 255.988903012 |
| |
| HMDB0245475 | 2,4,5-Trichlorophenoxyacetic acid | C8H5Cl3O3 255.483 253.930427147 |
| |
| HMDB0246171 | N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide | C11H14ClN3O2 255.7 255.0774544 |
| |
| HMDB0246453 | 1-(3-Chloro-4-hydroxyphenyl)-2-((1,1-dimethylethyl)amino)-1-propanone | C13H18ClNO2 255.74 255.1026065 |
| |
| HMDB0246521 | 4-Methylumbelliferyl phosphate | C10H9O6P 256.1486 256.013674532 |
| |
| HMDB0247883 | [(5R)-5-[(1S)-1,2-Dihydroxyethyl]-2,4-dioxooxolan-3-yl] dihydrogen phosphate | C6H9O9P 256.103 255.998418868 |
| |
| HMDB0248110 | Alaproclate | C13H18ClNO2 255.74 255.1026065 |
| |
| HMDB0251370 | Dimemorfan | C18H25N 255.405 255.198699809 |
| |
| HMDB0253587 | Irsogladine | C9H7Cl2N5 256.09 255.0078506 |
| |
| HMDB0256847 | Propyzamide | C12H11Cl2NO 256.128 255.021769393 |
| |
| HMDB0256928 | Purpurin | C14H8O5 256.213 256.037173358 |
| |
| HMDB0260226 | [(2R)-2-[(1S)-1,2-Dihydroxyethyl]-4,5-dioxooxolan-3-yl] dihydrogen phosphate | C6H9O9P 256.103 255.998418868 |
| |
| HMDB0341155 | Dimethachlor | C13H18ClNO2 255.74 255.1026065 |
|