Browsing Serum Metabolites
Clicking on any metabolite link will take you to the Human Metabolome Database.
Displaying metabolites 31681 - 31700 of 37231 in total
HMDB ID CAS Number | Name | Structure | Formula Average Mass Monoisotopic Mass | Biospecimen Location |
---|---|---|---|---|
HMDB0000855 1341-23-7 | Nicotinamide riboside | C11H15N2O5 255.2472 255.0980966 |
| |
HMDB0002275 1218-98-0 | 7,8-Dihydroneopterin | C9H13N5O4 255.2306 255.096753929 |
| |
HMDB0014608 66635-83-4 | Ketorolac | C15H13NO3 255.2686 255.089543287 |
| |
HMDB0014695 84057-84-1 | Lamotrigine | C9H7Cl2N5 256.091 255.007850663 |
| |
HMDB0015139 82410-32-0 | Ganciclovir | C9H13N5O4 255.2306 255.096753929 |
| |
HMDB0015619 72-14-0 | Sulfathiazole | C9H9N3O2S2 255.317 255.013617927 |
| |
HMDB0244432 | 6-(4-Methoxyphenyl)-2-methyl-7H-imidazo[1,2-a]pyrazin-3-one | C14H13N3O2 255.277 255.100776671 |
| |
HMDB0244465 | 2-Amino-6-[(1R,2S)-1,2,3-trihydroxypropyl]-7,8-dihydro-3H-pteridin-4-one | C9H13N5O4 255.2306 255.096753929 |
| |
HMDB0246171 | N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide | C11H14ClN3O2 255.7 255.0774544 |
| |
HMDB0246453 | 1-(3-Chloro-4-hydroxyphenyl)-2-((1,1-dimethylethyl)amino)-1-propanone | C13H18ClNO2 255.74 255.1026065 |
| |
HMDB0248110 | Alaproclate | C13H18ClNO2 255.74 255.1026065 |
| |
HMDB0248259 | Alrestatin | C14H9NO4 255.2256 255.053157781 |
| |
HMDB0248289 | Amfenac | C15H13NO3 255.273 255.089543283 |
| |
HMDB0250495 | 4-Methyl-2-oxo-2H-chromen-7-yl sulfamate | C10H9NO5S 255.24 255.020143568 |
| |
HMDB0252317 | Flosequinoxan | C11H10FNO3S 255.26 255.036542523 |
| |
HMDB0255306 | N7-(2-((Hydroxyethyl)thio)ethyl)guanine | C9H13N5O2S 255.3 255.078995853 |
| |
HMDB0255377 | 2-Amino-7-[(2R)-2,3-dihydroxypropanoyl]-5,6,7,8-tetrahydro-3H-pteridin-4-one | C9H13N5O4 255.234 255.096753919 |
| |
HMDB0256847 | Propyzamide | C12H11Cl2NO 256.128 255.021769393 |
| |
HMDB0258406 | Sparfosic acid | C6H10NO8P 255.119 255.014403284 |
| |
HMDB0341155 | Dimethachlor | C13H18ClNO2 255.74 255.1026065 |
|