Browsing Serum Metabolites
Clicking on any metabolite link will take you to the Human Metabolome Database.
Displaying metabolites 5541 - 5560 of 37231 in total
HMDB ID CAS Number | Name | Structure | Formula Average Mass Monoisotopic Mass | Biospecimen Location |
---|---|---|---|---|
HMDB0001927 147-24-0 | Diphenhydramine | C17H21NO 255.3547 255.162314299 |
| |
HMDB0012235 | Hydroxybupropion | C13H18ClNO2 255.741 255.102606532 |
| |
HMDB0014406 68475-42-3 | Anagrelide | C10H7Cl2N3O 256.088 254.996617275 |
| |
HMDB0014434 82248-59-7 | Atomoxetine | C17H21NO 255.3547 255.162314299 |
| |
HMDB0014930 91-81-6 | Tripelennamine | C16H21N3 255.358 255.173547687 |
| |
HMDB0015619 72-14-0 | Sulfathiazole | C9H9N3O2S2 255.317 255.013617927 |
| |
HMDB0060632 | N-Demethyl orphenadrine | C17H21NO 255.3547 255.162314299 |
| |
HMDB0245208 | 2-Methoxyphenylmetyrapone | C16H17NO2 255.317 255.125928791 |
| |
HMDB0245475 | 2,4,5-Trichlorophenoxyacetic acid | C8H5Cl3O3 255.483 253.930427147 |
| |
HMDB0245756 | 2,5-Dimethoxy-4-propylthiophenethylamine | C13H21NO2S 255.38 255.129300094 |
| |
HMDB0245926 | Maoto | C16H17NO2 255.317 255.125928791 |
| |
HMDB0246171 | N-(3-Chloro-4-morpholinophenyl)-N'-hydroxyformimidamide | C11H14ClN3O2 255.7 255.0774544 |
| |
HMDB0246453 | 1-(3-Chloro-4-hydroxyphenyl)-2-((1,1-dimethylethyl)amino)-1-propanone | C13H18ClNO2 255.74 255.1026065 |
| |
HMDB0248110 | Alaproclate | C13H18ClNO2 255.74 255.1026065 |
| |
HMDB0250490 | Coumarin 102 | C16H17NO2 255.317 255.125928791 |
| |
HMDB0251370 | Dimemorfan | C18H25N 255.405 255.198699809 |
| |
HMDB0253587 | Irsogladine | C9H7Cl2N5 256.09 255.0078506 |
| |
HMDB0255306 | N7-(2-((Hydroxyethyl)thio)ethyl)guanine | C9H13N5O2S 255.3 255.078995853 |
| |
HMDB0258327 | 2,3,4,5-Tetrahydro-7,8-dihydroxy-1-phenyl-1H-3-benzazepine | C16H17NO2 255.317 255.125928791 |
| |
HMDB0341155 | Dimethachlor | C13H18ClNO2 255.74 255.1026065 |
|